C12H9BrN4 — CID 116862752
2-(4-bromophenyl)-6-(methylamino)pyrimidine-4-carbonitrile (PubChem CID 116862752) has the molecular formula C12H9BrN4 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-(methylamino)pyrimidine-4-carbonitrile.
| Compound Name | 2-(4-bromophenyl)-6-(methylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 116862752 |
| Molecular Formula | C12H9BrN4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(4-bromophenyl)-6-(methylamino)pyrimidine-4-carbonitrile |
| SMILES | CNc1cc(C#N)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C12H9BrN4/c1-15-11-6-10(7-14)16-12(17-11)8-2-4-9(13)5-3-8/h2-6H,1H3,(H,15,16,17) |
| InChIKey | SGBVPHBGAWFJDI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |