C34H44Cl2F3N7O6S — CID 11686482
N'-(6-aminohexyl)-4-[2-[[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazine-1-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 11686482) has the molecular formula C34H44Cl2F3N7O6S and a molecular weight of 806.74 g/mol. Its IUPAC name is N'-(6-aminohexyl)-4-[2-[[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazine-1-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(6-aminohexyl)-4-[2-[[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazine-1-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11686482 |
| Molecular Formula | C34H44Cl2F3N7O6S |
| Molecular Weight | 806.74 g/mol |
| Exact Mass | 805.24 |
| IUPAC Name | N'-(6-aminohexyl)-4-[2-[[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazine-1-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC(C)(C)C(=O)N4CCN(/C(N)=N/CCCCCCN)CC4)c3Cl)c2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H43Cl2N7O4S.C2HF3O2/c1-22-11-12-23-9-8-10-26(29(23)38-22)45-21-24-25(33)13-14-27(28(24)34)46(43,44)39-32(2,3)30(42)40-17-19-41(20-18-40)31(36)37-16-7-5-4-6-15-35;3-2(4,5)1(6)7/h8-14,39H,4-7,15-21,35H2,1-3H3,(H2,36,37);(H,6,7) |
| InChIKey | HOKQZSNBOYEKMW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 193.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|