C15H19NOS — CID 116867562
1-[4-(2,3,5,6-tetramethylphenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 116867562) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-[4-(2,3,5,6-tetramethylphenyl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[4-(2,3,5,6-tetramethylphenyl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116867562 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-[4-(2,3,5,6-tetramethylphenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | Cc1cc(C)c(C)c(-c2csc(C(C)O)n2)c1C |
| InChI | InChI=1S/C15H19NOS/c1-8-6-9(2)11(4)14(10(8)3)13-7-18-15(16-13)12(5)17/h6-7,12,17H,1-5H3 |
| InChIKey | ZWKPPQACVWSBQF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |