C12H10N2OS2 — CID 55184370
1-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]ethanol (PubChem CID 55184370) has the molecular formula C12H10N2OS2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 55184370 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]ethanol |
| SMILES | CC(O)c1nc(-c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C12H10N2OS2/c1-7(15)11-14-9(6-16-11)12-13-8-4-2-3-5-10(8)17-12/h2-7,15H,1H3 |
| InChIKey | XKIOVRGQYNEISU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |