C10H12N2OS — CID 116867629
1-[5-methyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]ethanol (PubChem CID 116867629) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-[5-methyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[5-methyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116867629 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-[5-methyl-4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]ethanol |
| SMILES | Cc1sc(C(C)O)nc1-c1ccc[nH]1 |
| InChI | InChI=1S/C10H12N2OS/c1-6(13)10-12-9(7(2)14-10)8-4-3-5-11-8/h3-6,11,13H,1-2H3 |
| InChIKey | USZRMQCEDLLIIS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |