C14H21NO2 — CID 116874495
2-amino-1-[3-(2,4,5-trimethylphenyl)oxetan-3-yl]ethanol (PubChem CID 116874495) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-amino-1-[3-(2,4,5-trimethylphenyl)oxetan-3-yl]ethanol.
| Compound Name | 2-amino-1-[3-(2,4,5-trimethylphenyl)oxetan-3-yl]ethanol |
|---|---|
| PubChem CID | 116874495 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-amino-1-[3-(2,4,5-trimethylphenyl)oxetan-3-yl]ethanol |
| SMILES | Cc1cc(C)c(C2(C(O)CN)COC2)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-9-4-11(3)12(5-10(9)2)14(7-17-8-14)13(16)6-15/h4-5,13,16H,6-8,15H2,1-3H3 |
| InChIKey | WCPVKUALOYHQEY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |