About 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine
2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine (PubChem CID 11687687) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine |
| PubChem CID | 11687687 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine |
| SMILES | Cc1cc(C(OCCN(C)C)c2ccccc2)n(C)n1 |
| InChI | InChI=1S/C16H23N3O/c1-13-12-15(19(4)17-13)16(20-11-10-18(2)3)14-8-6-5-7-9-14/h5-9,12,16H,10-11H2,1-4H3 |
| InChIKey | IUHGHUIFWRTGTR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine (CID 11687687) is 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine is Cc1cc(C(OCCN(C)C)c2ccccc2)n(C)n1.
What is the InChIKey of 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine?
The InChIKey is IUHGHUIFWRTGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-13-12-15(19(4)17-13)16(20-11-10-18(2)3)14-8-6-5-7-9-14/h5-9,12,16H,10-11H2,1-4H3.
What are the key properties of 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine?
2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine has a molecular weight of 273.38 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylpyrazol-3-yl)-phenylmethoxy]-N,N-dimethylethanamine is sourced from PubChem (CID 11687687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).