About 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine
3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine (PubChem CID 116877211) has the molecular formula C15H19N5
and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine |
| PubChem CID | 116877211 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CN)Cc1ncc(-c2ccc3nc[nH]c3c2)[nH]1 |
| InChI | InChI=1S/C15H19N5/c1-15(2,8-16)6-14-17-7-13(20-14)10-3-4-11-12(5-10)19-9-18-11/h3-5,7,9H,6,8,16H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | HAXHPWMXPGFMMV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine?
The IUPAC name of 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine (CID 116877211) is 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine?
The canonical SMILES for 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine is CC(C)(CN)Cc1ncc(-c2ccc3nc[nH]c3c2)[nH]1.
What is the InChIKey of 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine?
The InChIKey is HAXHPWMXPGFMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5/c1-15(2,8-16)6-14-17-7-13(20-14)10-3-4-11-12(5-10)19-9-18-11/h3-5,7,9H,6,8,16H2,1-2H3,(H,17,20)(H,18,19).
What are the key properties of 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine?
3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine has a molecular weight of 269.35 g/mol, XLogP of 2.48, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3H-benzimidazol-5-yl)-1H-imidazol-2-yl]-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 116877211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).