C8H8ClN3 — CID 116878077
2-(chloromethyl)-5-(1H-pyrrol-3-yl)-1H-imidazole (PubChem CID 116878077) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(1H-pyrrol-3-yl)-1H-imidazole.
| Compound Name | 2-(chloromethyl)-5-(1H-pyrrol-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 116878077 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-(chloromethyl)-5-(1H-pyrrol-3-yl)-1H-imidazole |
| SMILES | ClCc1ncc(-c2cc[nH]c2)[nH]1 |
| InChI | InChI=1S/C8H8ClN3/c9-3-8-11-5-7(12-8)6-1-2-10-4-6/h1-2,4-5,10H,3H2,(H,11,12) |
| InChIKey | LDFAPBRWOBPAMU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|