C9H9N3O2 — CID 116880364
methyl 5-(1H-pyrrol-3-yl)-1H-imidazole-2-carboxylate (PubChem CID 116880364) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 5-(1H-pyrrol-3-yl)-1H-imidazole-2-carboxylate.
| Compound Name | methyl 5-(1H-pyrrol-3-yl)-1H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 116880364 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methyl 5-(1H-pyrrol-3-yl)-1H-imidazole-2-carboxylate |
| SMILES | COC(=O)c1ncc(-c2cc[nH]c2)[nH]1 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)8-11-5-7(12-8)6-2-3-10-4-6/h2-5,10H,1H3,(H,11,12) |
| InChIKey | CRBZFZMTELLCNT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |