C11H8ClN3O2 — CID 116878109
5-[2-(chloromethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 116878109) has the molecular formula C11H8ClN3O2 and a molecular weight of 249.66 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-(chloromethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116878109 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-[2-(chloromethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(-c3cnc(CCl)[nH]3)ccc2o1 |
| InChI | InChI=1S/C11H8ClN3O2/c12-4-10-13-5-8(14-10)6-1-2-9-7(3-6)15-11(16)17-9/h1-3,5H,4H2,(H,13,14)(H,15,16) |
| InChIKey | RWNAUFVLUPSJCY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|