C12H9N3O2S — CID 116900382
5-[2-(sulfanylmethyl)pyrimidin-4-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 116900382) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 5-[2-(sulfanylmethyl)pyrimidin-4-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-(sulfanylmethyl)pyrimidin-4-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116900382 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 5-[2-(sulfanylmethyl)pyrimidin-4-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(-c3ccnc(CS)n3)ccc2o1 |
| InChI | InChI=1S/C12H9N3O2S/c16-12-15-9-5-7(1-2-10(9)17-12)8-3-4-13-11(6-18)14-8/h1-5,18H,6H2,(H,15,16) |
| InChIKey | WUQROGCSKGQLDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|