C12H11N3O2S — CID 116879346
5-[2-(2-sulfanylethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 116879346) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 5-[2-(2-sulfanylethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-(2-sulfanylethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116879346 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-[2-(2-sulfanylethyl)-1H-imidazol-5-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(-c3cnc(CCS)[nH]3)ccc2o1 |
| InChI | InChI=1S/C12H11N3O2S/c16-12-15-8-5-7(1-2-10(8)17-12)9-6-13-11(14-9)3-4-18/h1-2,5-6,18H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | YWGQHWUZVORCCC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|