C15H12N2O2 — CID 116878561
5-(6-methylnaphthalen-2-yl)-1H-imidazole-2-carboxylic acid (PubChem CID 116878561) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-(6-methylnaphthalen-2-yl)-1H-imidazole-2-carboxylic acid.
| Compound Name | 5-(6-methylnaphthalen-2-yl)-1H-imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 116878561 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-(6-methylnaphthalen-2-yl)-1H-imidazole-2-carboxylic acid |
| SMILES | Cc1ccc2cc(-c3cnc(C(=O)O)[nH]3)ccc2c1 |
| InChI | InChI=1S/C15H12N2O2/c1-9-2-3-11-7-12(5-4-10(11)6-9)13-8-16-14(17-13)15(18)19/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | DAXLGLAZIMBHSZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |