C15H14N2S — CID 116879256
[5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol (PubChem CID 116879256) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is [5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol.
| Compound Name | [5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 116879256 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol |
| SMILES | Cc1ccc2cc(-c3cnc(CS)[nH]3)ccc2c1 |
| InChI | InChI=1S/C15H14N2S/c1-10-2-3-12-7-13(5-4-11(12)6-10)14-8-16-15(9-18)17-14/h2-8,18H,9H2,1H3,(H,16,17) |
| InChIKey | CWFVHEMGQWGFRP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|