C14H16N2S — CID 116879138
[5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol (PubChem CID 116879138) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is [5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol.
| Compound Name | [5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 116879138 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-imidazol-2-yl]methanethiol |
| SMILES | SCc1ncc(-c2ccc3c(c2)CCCC3)[nH]1 |
| InChI | InChI=1S/C14H16N2S/c17-9-14-15-8-13(16-14)12-6-5-10-3-1-2-4-11(10)7-12/h5-8,17H,1-4,9H2,(H,15,16) |
| InChIKey | XLXHPKYYPQZNDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|