C11H10ClFN2S — CID 116879266
[5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazol-2-yl]methanethiol (PubChem CID 116879266) has the molecular formula C11H10ClFN2S and a molecular weight of 256.73 g/mol. Its IUPAC name is [5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazol-2-yl]methanethiol.
| Compound Name | [5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 116879266 |
| Molecular Formula | C11H10ClFN2S |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | [5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazol-2-yl]methanethiol |
| SMILES | Cc1cc(Cl)c(-c2cnc(CS)[nH]2)cc1F |
| InChI | InChI=1S/C11H10ClFN2S/c1-6-2-8(12)7(3-9(6)13)10-4-14-11(5-16)15-10/h2-4,16H,5H2,1H3,(H,14,15) |
| InChIKey | XVEHSKJLIFIPRI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|