C10H6N2O2S2 — CID 116889686
6-(4-sulfanyl-1,3-thiazol-2-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 116889686) has the molecular formula C10H6N2O2S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(4-sulfanyl-1,3-thiazol-2-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-sulfanyl-1,3-thiazol-2-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116889686 |
| Molecular Formula | C10H6N2O2S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 6-(4-sulfanyl-1,3-thiazol-2-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(-c3nc(S)cs3)cc2o1 |
| InChI | InChI=1S/C10H6N2O2S2/c13-10-11-6-2-1-5(3-7(6)14-10)9-12-8(15)4-16-9/h1-4,15H,(H,11,13) |
| InChIKey | NMMKKLVAGRJOEX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|