C17H12N2O2S — CID 17456976
6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 17456976) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 17456976 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(-c2nc(-c3ccc4[nH]c(=O)oc4c3)cs2)cc1 |
| InChI | InChI=1S/C17H12N2O2S/c1-10-2-4-11(5-3-10)16-18-14(9-22-16)12-6-7-13-15(8-12)21-17(20)19-13/h2-9H,1H3,(H,19,20) |
| InChIKey | DJYIFPCXYGTYIJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |