C12H15N3S2 — CID 116889895
2-(3-methylthiophen-2-yl)-4-piperazin-1-yl-1,3-thiazole (PubChem CID 116889895) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)-4-piperazin-1-yl-1,3-thiazole.
| Compound Name | 2-(3-methylthiophen-2-yl)-4-piperazin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116889895 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)-4-piperazin-1-yl-1,3-thiazole |
| SMILES | Cc1ccsc1-c1nc(N2CCNCC2)cs1 |
| InChI | InChI=1S/C12H15N3S2/c1-9-2-7-16-11(9)12-14-10(8-17-12)15-5-3-13-4-6-15/h2,7-8,13H,3-6H2,1H3 |
| InChIKey | CDORLCYUKVTJLD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |