About 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine
1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine (PubChem CID 162549104) has the molecular formula C12H17F2N3
and a molecular weight of 241.28 g/mol. Its IUPAC name is 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine.
Molecular Properties
| Compound Name | 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine |
| PubChem CID | 162549104 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine |
| SMILES | Cc1nc(N2CCNCC2)ccc1C(C)(F)F |
| InChI | InChI=1S/C12H17F2N3/c1-9-10(12(2,13)14)3-4-11(16-9)17-7-5-15-6-8-17/h3-4,15H,5-8H2,1-2H3 |
| InChIKey | HOPLKCJGZSPWOS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine?
The IUPAC name of 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine (CID 162549104) is 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine.
What is the SMILES notation for 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine?
The canonical SMILES for 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine is Cc1nc(N2CCNCC2)ccc1C(C)(F)F.
What is the InChIKey of 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine?
The InChIKey is HOPLKCJGZSPWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3/c1-9-10(12(2,13)14)3-4-11(16-9)17-7-5-15-6-8-17/h3-4,15H,5-8H2,1-2H3.
What are the key properties of 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine?
1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine has a molecular weight of 241.28 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(1,1-difluoroethyl)-6-methyl-2-pyridinyl]piperazine is sourced from PubChem (CID 162549104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).