C12H16F3N3S — CID 11725490
1-[6-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 11725490) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[6-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[6-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 11725490 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[6-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | CCSc1nc(N2CCNCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3S/c1-2-19-11-9(12(13,14)15)3-4-10(17-11)18-7-5-16-6-8-18/h3-4,16H,2,5-8H2,1H3 |
| InChIKey | GGIPYRBPIJCYSD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |