About 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole
2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole (PubChem CID 166859235) has the molecular formula C12H14FN5S
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole |
| PubChem CID | 166859235 |
| Molecular Formula | C12H14FN5S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(-c2nc(N3CCNCC3)ccc2F)s1 |
| InChI | InChI=1S/C12H14FN5S/c1-8-16-17-12(19-8)11-9(13)2-3-10(15-11)18-6-4-14-5-7-18/h2-3,14H,4-7H2,1H3 |
| InChIKey | IROXECUPMUPIJI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole?
The IUPAC name of 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole (CID 166859235) is 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole?
The canonical SMILES for 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole is Cc1nnc(-c2nc(N3CCNCC3)ccc2F)s1.
What is the InChIKey of 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole?
The InChIKey is IROXECUPMUPIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN5S/c1-8-16-17-12(19-8)11-9(13)2-3-10(15-11)18-6-4-14-5-7-18/h2-3,14H,4-7H2,1H3.
What are the key properties of 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole?
2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole has a molecular weight of 279.34 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-6-piperazin-1-yl-2-pyridinyl)-5-methyl-1,3,4-thiadiazole is sourced from PubChem (CID 166859235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).