C11H14N4 — CID 68568912
6-piperazin-1-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 68568912) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-piperazin-1-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-piperazin-1-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 68568912 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-piperazin-1-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cc2ccc(N3CCNCC3)nc2[nH]1 |
| InChI | InChI=1S/C11H14N4/c1-2-10(15-7-5-12-6-8-15)14-11-9(1)3-4-13-11/h1-4,12H,5-8H2,(H,13,14) |
| InChIKey | LJRWQUDNKBCSSJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |