C10H8N2S2 — CID 116890038
3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanenitrile (PubChem CID 116890038) has the molecular formula C10H8N2S2 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanenitrile.
| Compound Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanenitrile |
|---|---|
| PubChem CID | 116890038 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)propanenitrile |
| SMILES | N#CCCc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C10H8N2S2/c11-5-1-3-8-7-14-10(12-8)9-4-2-6-13-9/h2,4,6-7H,1,3H2 |
| InChIKey | VBPJHNOZXDZCHH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |