C13H12N2O2S — CID 116891028
1-(2-pyridin-2-yl-1,3-thiazol-4-yl)cyclobutane-1-carboxylic acid (PubChem CID 116891028) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-(2-pyridin-2-yl-1,3-thiazol-4-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-pyridin-2-yl-1,3-thiazol-4-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 116891028 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(2-pyridin-2-yl-1,3-thiazol-4-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2csc(-c3ccccn3)n2)CCC1 |
| InChI | InChI=1S/C13H12N2O2S/c16-12(17)13(5-3-6-13)10-8-18-11(15-10)9-4-1-2-7-14-9/h1-2,4,7-8H,3,5-6H2,(H,16,17) |
| InChIKey | KKZPMMJFDANUFY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |