1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid

C13H17NO3S — CID 116891034

IUPAC1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(c2csc(C3CCOCC3)n2)CCC1
InChIInChI=1S/C13H17NO3S/c15-12(16)13(4-1-5-13)10-8-18-11(14-10)9-2-6-17-7-3-9/h8-9H,1-7H2,(H,15,16)
InChIKeyPODZJVXEAUHHKD-UHFFFAOYSA-N
MW267.35 g/mol
LogP2.54
Rot. Bonds3

About 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid

1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid (PubChem CID 116891034) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid
PubChem CID116891034
Molecular FormulaC13H17NO3S
Molecular Weight267.35 g/mol
Exact Mass267.09
IUPAC Name1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(c2csc(C3CCOCC3)n2)CCC1
InChIInChI=1S/C13H17NO3S/c15-12(16)13(4-1-5-13)10-8-18-11(14-10)9-2-6-17-7-3-9/h8-9H,1-7H2,(H,15,16)
InChIKeyPODZJVXEAUHHKD-UHFFFAOYSA-N
XLogP2.54
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.35
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid (CID 116891034) is 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid is O=C(O)C1(c2csc(C3CCOCC3)n2)CCC1.
What is the InChIKey of 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid?
The InChIKey is PODZJVXEAUHHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c15-12(16)13(4-1-5-13)10-8-18-11(14-10)9-2-6-17-7-3-9/h8-9H,1-7H2,(H,15,16).
What are the key properties of 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid?
1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid has a molecular weight of 267.35 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 116891034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).