C13H11BrN2S — CID 116891477
2-[2-(4-bromophenyl)-1,3-thiazol-4-yl]butanenitrile (PubChem CID 116891477) has the molecular formula C13H11BrN2S and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-1,3-thiazol-4-yl]butanenitrile.
| Compound Name | 2-[2-(4-bromophenyl)-1,3-thiazol-4-yl]butanenitrile |
|---|---|
| PubChem CID | 116891477 |
| Molecular Formula | C13H11BrN2S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-[2-(4-bromophenyl)-1,3-thiazol-4-yl]butanenitrile |
| SMILES | CCC(C#N)c1csc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C13H11BrN2S/c1-2-9(7-15)12-8-17-13(16-12)10-3-5-11(14)6-4-10/h3-6,8-9H,2H2,1H3 |
| InChIKey | HBACULHFQHBHES-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |