C13H11FN2S — CID 116891500
2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]butanenitrile (PubChem CID 116891500) has the molecular formula C13H11FN2S and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]butanenitrile.
| Compound Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]butanenitrile |
|---|---|
| PubChem CID | 116891500 |
| Molecular Formula | C13H11FN2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]butanenitrile |
| SMILES | CCC(C#N)c1csc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H11FN2S/c1-2-9(7-15)12-8-17-13(16-12)10-4-3-5-11(14)6-10/h3-6,8-9H,2H2,1H3 |
| InChIKey | VZORPHUXKJVFDS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |