C12H13FN2S2 — CID 95472481
2-[[2-(3-fluorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine (PubChem CID 95472481) has the molecular formula C12H13FN2S2 and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[[2-(3-fluorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine.
| Compound Name | 2-[[2-(3-fluorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 95472481 |
| Molecular Formula | C12H13FN2S2 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[[2-(3-fluorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine |
| SMILES | NCCSCc1csc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C12H13FN2S2/c13-10-3-1-2-9(6-10)12-15-11(8-17-12)7-16-5-4-14/h1-3,6,8H,4-5,7,14H2 |
| InChIKey | NOYRAQURWYEDJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|