C11H16N2O2S — CID 116891647
2-(2-cyclopentyl-1,3-thiazol-4-yl)-2-(methylamino)acetic acid (PubChem CID 116891647) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(2-cyclopentyl-1,3-thiazol-4-yl)-2-(methylamino)acetic acid.
| Compound Name | 2-(2-cyclopentyl-1,3-thiazol-4-yl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 116891647 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(2-cyclopentyl-1,3-thiazol-4-yl)-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)c1csc(C2CCCC2)n1 |
| InChI | InChI=1S/C11H16N2O2S/c1-12-9(11(14)15)8-6-16-10(13-8)7-4-2-3-5-7/h6-7,9,12H,2-5H2,1H3,(H,14,15) |
| InChIKey | HRYDNRYDYWILBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |