C11H10BrN3O2S — CID 116903492
2-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]-2-(methylamino)acetic acid (PubChem CID 116903492) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 2-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]-2-(methylamino)acetic acid.
| Compound Name | 2-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 116903492 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)c1nccc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C11H10BrN3O2S/c1-13-9(11(16)17)10-14-3-2-7(15-10)8-4-6(12)5-18-8/h2-5,9,13H,1H3,(H,16,17) |
| InChIKey | XLEDHZWMSYJLSV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |