C7H8BrNO2S — CID 130524708
2-(5-bromothiophen-3-yl)-2-(methylamino)acetic acid (PubChem CID 130524708) has the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. Its IUPAC name is 2-(5-bromothiophen-3-yl)-2-(methylamino)acetic acid.
| Compound Name | 2-(5-bromothiophen-3-yl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 130524708 |
| Molecular Formula | C7H8BrNO2S |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | 2-(5-bromothiophen-3-yl)-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)c1csc(Br)c1 |
| InChI | InChI=1S/C7H8BrNO2S/c1-9-6(7(10)11)4-2-5(8)12-3-4/h2-3,6,9H,1H3,(H,10,11) |
| InChIKey | OVEHUBQODLVWBL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |