C17H28N2 — CID 116905443
N,N,3-trimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-diamine (PubChem CID 116905443) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N,N,3-trimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-diamine.
| Compound Name | N,N,3-trimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905443 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N,N,3-trimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-diamine |
| SMILES | CC(CN)CC(c1ccc2c(c1)CCCC2)N(C)C |
| InChI | InChI=1S/C17H28N2/c1-13(12-18)10-17(19(2)3)16-9-8-14-6-4-5-7-15(14)11-16/h8-9,11,13,17H,4-7,10,12,18H2,1-3H3 |
| InChIKey | UYBRGXPKYKDAJY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |