C11H19N3 — CID 116907314
3-[dimethylamino(1H-pyrrol-3-yl)methyl]cyclobutan-1-amine (PubChem CID 116907314) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-[dimethylamino(1H-pyrrol-3-yl)methyl]cyclobutan-1-amine.
| Compound Name | 3-[dimethylamino(1H-pyrrol-3-yl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 116907314 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-[dimethylamino(1H-pyrrol-3-yl)methyl]cyclobutan-1-amine |
| SMILES | CN(C)C(c1cc[nH]c1)C1CC(N)C1 |
| InChI | InChI=1S/C11H19N3/c1-14(2)11(8-3-4-13-7-8)9-5-10(12)6-9/h3-4,7,9-11,13H,5-6,12H2,1-2H3 |
| InChIKey | YSPIOBHHHMGVTM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |