C11H21N3 — CID 116905378
N,N,2-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine (PubChem CID 116905378) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N,N,2-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine.
| Compound Name | N,N,2-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905378 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N,N,2-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
| SMILES | CC(CCN)C(c1cc[nH]c1)N(C)C |
| InChI | InChI=1S/C11H21N3/c1-9(4-6-12)11(14(2)3)10-5-7-13-8-10/h5,7-9,11,13H,4,6,12H2,1-3H3 |
| InChIKey | KHWAGAJXOOVRRH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |