C12H20N2O2 — CID 116913167
2-[dimethylamino(1H-pyrrol-3-yl)methyl]-3-methylbutanoic acid (PubChem CID 116913167) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[dimethylamino(1H-pyrrol-3-yl)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[dimethylamino(1H-pyrrol-3-yl)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 116913167 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-[dimethylamino(1H-pyrrol-3-yl)methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)C(c1cc[nH]c1)N(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-8(2)10(12(15)16)11(14(3)4)9-5-6-13-7-9/h5-8,10-11,13H,1-4H3,(H,15,16) |
| InChIKey | MNGQAAGJTIOBBI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |