C11H18N2O2 — CID 116908269
4-(dimethylamino)-2-methyl-4-(1H-pyrrol-3-yl)butanoic acid (PubChem CID 116908269) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methyl-4-(1H-pyrrol-3-yl)butanoic acid.
| Compound Name | 4-(dimethylamino)-2-methyl-4-(1H-pyrrol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 116908269 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-(dimethylamino)-2-methyl-4-(1H-pyrrol-3-yl)butanoic acid |
| SMILES | CC(CC(c1cc[nH]c1)N(C)C)C(=O)O |
| InChI | InChI=1S/C11H18N2O2/c1-8(11(14)15)6-10(13(2)3)9-4-5-12-7-9/h4-5,7-8,10,12H,6H2,1-3H3,(H,14,15) |
| InChIKey | PLDOWYGEFBLVBS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |