C15H21N3O — CID 116910841
1-(1H-indol-3-yl)-N,N-dimethyl-1-morpholin-2-ylmethanamine (PubChem CID 116910841) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N,N-dimethyl-1-morpholin-2-ylmethanamine.
| Compound Name | 1-(1H-indol-3-yl)-N,N-dimethyl-1-morpholin-2-ylmethanamine |
|---|---|
| PubChem CID | 116910841 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(1H-indol-3-yl)-N,N-dimethyl-1-morpholin-2-ylmethanamine |
| SMILES | CN(C)C(c1c[nH]c2ccccc12)C1CNCCO1 |
| InChI | InChI=1S/C15H21N3O/c1-18(2)15(14-10-16-7-8-19-14)12-9-17-13-6-4-3-5-11(12)13/h3-6,9,14-17H,7-8,10H2,1-2H3 |
| InChIKey | BZNIPCPIDBKIDJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |