C11H17NO2S — CID 116912949
[3-[dimethylamino(thiophen-2-yl)methyl]oxetan-3-yl]methanol (PubChem CID 116912949) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is [3-[dimethylamino(thiophen-2-yl)methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[dimethylamino(thiophen-2-yl)methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116912949 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | [3-[dimethylamino(thiophen-2-yl)methyl]oxetan-3-yl]methanol |
| SMILES | CN(C)C(c1cccs1)C1(CO)COC1 |
| InChI | InChI=1S/C11H17NO2S/c1-12(2)10(9-4-3-5-15-9)11(6-13)7-14-8-11/h3-5,10,13H,6-8H2,1-2H3 |
| InChIKey | JJZGWTMIRPAZAW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |