C12H27N3 — CID 116913942
N,N-dimethyl-5-piperazin-1-ylhexan-3-amine (PubChem CID 116913942) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is N,N-dimethyl-5-piperazin-1-ylhexan-3-amine.
| Compound Name | N,N-dimethyl-5-piperazin-1-ylhexan-3-amine |
|---|---|
| PubChem CID | 116913942 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N,N-dimethyl-5-piperazin-1-ylhexan-3-amine |
| SMILES | CCC(CC(C)N1CCNCC1)N(C)C |
| InChI | InChI=1S/C12H27N3/c1-5-12(14(3)4)10-11(2)15-8-6-13-7-9-15/h11-13H,5-10H2,1-4H3 |
| InChIKey | YBOKWYPFQJQDHX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |