C24H25ClFN3O6 — CID 11691917
ethyl 1-[2-[2-(carbamoylamino)-4-chlorophenoxy]acetyl]-4-[(4-fluorophenyl)methyl]-3-oxopiperidine-4-carboxylate (PubChem CID 11691917) has the molecular formula C24H25ClFN3O6 and a molecular weight of 505.93 g/mol. Its IUPAC name is ethyl 1-[2-[2-(carbamoylamino)-4-chlorophenoxy]acetyl]-4-[(4-fluorophenyl)methyl]-3-oxopiperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(carbamoylamino)-4-chlorophenoxy]acetyl]-4-[(4-fluorophenyl)methyl]-3-oxopiperidine-4-carboxylate |
|---|---|
| PubChem CID | 11691917 |
| Molecular Formula | C24H25ClFN3O6 |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | ethyl 1-[2-[2-(carbamoylamino)-4-chlorophenoxy]acetyl]-4-[(4-fluorophenyl)methyl]-3-oxopiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(F)cc2)CCN(C(=O)COc2ccc(Cl)cc2NC(N)=O)CC1=O |
| InChI | InChI=1S/C24H25ClFN3O6/c1-2-34-22(32)24(12-15-3-6-17(26)7-4-15)9-10-29(13-20(24)30)21(31)14-35-19-8-5-16(25)11-18(19)28-23(27)33/h3-8,11H,2,9-10,12-14H2,1H3,(H3,27,28,33) |
| InChIKey | XQEHAAXADPYTCI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|