C21H22ClFN4O7S — CID 141144835
[2-[2-[(3aR)-7-[(4-fluorophenyl)methyl]-3a-methyl-2,2-dioxo-6,7a-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyrazin-4-yl]-2-oxoethoxy]-5-chlorophenyl]urea (PubChem CID 141144835) has the molecular formula C21H22ClFN4O7S and a molecular weight of 528.95 g/mol. Its IUPAC name is [2-[2-[(3aR)-7-[(4-fluorophenyl)methyl]-3a-methyl-2,2-dioxo-6,7a-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyrazin-4-yl]-2-oxoethoxy]-5-chlorophenyl]urea.
| Compound Name | [2-[2-[(3aR)-7-[(4-fluorophenyl)methyl]-3a-methyl-2,2-dioxo-6,7a-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyrazin-4-yl]-2-oxoethoxy]-5-chlorophenyl]urea |
|---|---|
| PubChem CID | 141144835 |
| Molecular Formula | C21H22ClFN4O7S |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | [2-[2-[(3aR)-7-[(4-fluorophenyl)methyl]-3a-methyl-2,2-dioxo-6,7a-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyrazin-4-yl]-2-oxoethoxy]-5-chlorophenyl]urea |
| SMILES | C[C@@]12OS(=O)(=O)OC1N(Cc1ccc(F)cc1)CCN2C(=O)COc1ccc(Cl)cc1NC(N)=O |
| InChI | InChI=1S/C21H22ClFN4O7S/c1-21-19(33-35(30,31)34-21)26(11-13-2-5-15(23)6-3-13)8-9-27(21)18(28)12-32-17-7-4-14(22)10-16(17)25-20(24)29/h2-7,10,19H,8-9,11-12H2,1H3,(H3,24,25,29)/t19?,21-/m1/s1 |
| InChIKey | QLZRVVWYTWOPGI-VGAJERRHSA-N |
| XLogP | 2.03 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |