About (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone
(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone (PubChem CID 116919627) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone.
Molecular Properties
| Compound Name | (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone |
| PubChem CID | 116919627 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone |
| SMILES | Cc1cc2c(cc1C(=O)C1COCCN1)OCCO2 |
| InChI | InChI=1S/C14H17NO4/c1-9-6-12-13(19-5-4-18-12)7-10(9)14(16)11-8-17-3-2-15-11/h6-7,11,15H,2-5,8H2,1H3 |
| InChIKey | PMBQQTDEICFUCK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone?
The IUPAC name of (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone (CID 116919627) is (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone.
What is the SMILES notation for (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone?
The canonical SMILES for (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone is Cc1cc2c(cc1C(=O)C1COCCN1)OCCO2.
What is the InChIKey of (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone?
The InChIKey is PMBQQTDEICFUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-9-6-12-13(19-5-4-18-12)7-10(9)14(16)11-8-17-3-2-15-11/h6-7,11,15H,2-5,8H2,1H3.
What are the key properties of (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone?
(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone has a molecular weight of 263.29 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-morpholin-3-ylmethanone is sourced from PubChem (CID 116919627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).