C11H15ClN2O3 — CID 178103013
(4-methoxy-3-pyridinyl)-[(3R)-morpholin-3-yl]methanone;hydrochloride (PubChem CID 178103013) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is (4-methoxy-3-pyridinyl)-[(3R)-morpholin-3-yl]methanone;hydrochloride.
| Compound Name | (4-methoxy-3-pyridinyl)-[(3R)-morpholin-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 178103013 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (4-methoxy-3-pyridinyl)-[(3R)-morpholin-3-yl]methanone;hydrochloride |
| SMILES | COc1ccncc1C(=O)[C@H]1COCCN1.Cl |
| InChI | InChI=1S/C11H14N2O3.ClH/c1-15-10-2-3-12-6-8(10)11(14)9-7-16-5-4-13-9;/h2-3,6,9,13H,4-5,7H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | WPCJLECGHILCLS-SBSPUUFOSA-N |
| XLogP | 0.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |