C15H20N2O2 — CID 116925717
3-methyl-5-(2-piperidin-4-ylethyl)-1,3-benzoxazol-2-one (PubChem CID 116925717) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-methyl-5-(2-piperidin-4-ylethyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-(2-piperidin-4-ylethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116925717 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-methyl-5-(2-piperidin-4-ylethyl)-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(CCC3CCNCC3)cc21 |
| InChI | InChI=1S/C15H20N2O2/c1-17-13-10-12(4-5-14(13)19-15(17)18)3-2-11-6-8-16-9-7-11/h4-5,10-11,16H,2-3,6-9H2,1H3 |
| InChIKey | KEBUFGGHVRHUFX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |