C14H18N2O2 — CID 116928496
5-[(4-hydroxycyclohexyl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 116928496) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-[(4-hydroxycyclohexyl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(4-hydroxycyclohexyl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 116928496 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-[(4-hydroxycyclohexyl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(CC3CCC(O)CC3)cc2[nH]1 |
| InChI | InChI=1S/C14H18N2O2/c17-11-4-1-9(2-5-11)7-10-3-6-12-13(8-10)16-14(18)15-12/h3,6,8-9,11,17H,1-2,4-5,7H2,(H2,15,16,18) |
| InChIKey | AHGREOOQMCYEDQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |