C9H10N2O2S — CID 22745192
5-(methylsulfinylmethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 22745192) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-(methylsulfinylmethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(methylsulfinylmethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 22745192 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-(methylsulfinylmethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CS(=O)Cc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H10N2O2S/c1-14(13)5-6-2-3-7-8(4-6)11-9(12)10-7/h2-4H,5H2,1H3,(H2,10,11,12) |
| InChIKey | NKJCXDKYVRAIBA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |