C14H18BrNO3 — CID 116940947
(E)-4-amino-4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)but-2-enoic acid (PubChem CID 116940947) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is (E)-4-amino-4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)but-2-enoic acid.
| Compound Name | (E)-4-amino-4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 116940947 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (E)-4-amino-4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)but-2-enoic acid |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1C(N)/C=C/C(=O)O |
| InChI | InChI=1S/C14H18BrNO3/c1-7-8(2)14(19-4)12(9(3)13(7)15)10(16)5-6-11(17)18/h5-6,10H,16H2,1-4H3,(H,17,18)/b6-5+ |
| InChIKey | DSLHTGOLQLTGQR-AATRIKPKSA-N |
| XLogP | 3.02 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|