C14H20N2OS — CID 116941188
3,4-dihydro-2H-thiochromen-6-yl(morpholin-3-yl)methanamine (PubChem CID 116941188) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-6-yl(morpholin-3-yl)methanamine.
| Compound Name | 3,4-dihydro-2H-thiochromen-6-yl(morpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 116941188 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-6-yl(morpholin-3-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)CCCS2)C1COCCN1 |
| InChI | InChI=1S/C14H20N2OS/c15-14(12-9-17-6-5-16-12)11-3-4-13-10(8-11)2-1-7-18-13/h3-4,8,12,14,16H,1-2,5-7,9,15H2 |
| InChIKey | NUTBVZNCUYNFFD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |